C25H32BN3O5 — CID 174058598
[1-[[5-benzyl-3-[[(2-phenylacetyl)amino]methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 174058598) has the molecular formula C25H32BN3O5 and a molecular weight of 465.36 g/mol. Its IUPAC name is [1-[[5-benzyl-3-[[(2-phenylacetyl)amino]methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [1-[[5-benzyl-3-[[(2-phenylacetyl)amino]methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 174058598 |
| Molecular Formula | C25H32BN3O5 |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | [1-[[5-benzyl-3-[[(2-phenylacetyl)amino]methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C1(Cc2ccccc2)CC(CNC(=O)Cc2ccccc2)=NO1)B(O)O |
| InChI | InChI=1S/C25H32BN3O5/c1-18(2)13-22(26(32)33)28-24(31)25(15-20-11-7-4-8-12-20)16-21(29-34-25)17-27-23(30)14-19-9-5-3-6-10-19/h3-12,18,22,32-33H,13-17H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | AYAIGFDWFKLGOY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|