C26H30BN5O5 — CID 174058384
[1-[[5-benzyl-3-[(quinoxaline-2-carbonylamino)methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 174058384) has the molecular formula C26H30BN5O5 and a molecular weight of 503.37 g/mol. Its IUPAC name is [1-[[5-benzyl-3-[(quinoxaline-2-carbonylamino)methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [1-[[5-benzyl-3-[(quinoxaline-2-carbonylamino)methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 174058384 |
| Molecular Formula | C26H30BN5O5 |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [1-[[5-benzyl-3-[(quinoxaline-2-carbonylamino)methyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C1(Cc2ccccc2)CC(CNC(=O)c2cnc3ccccc3n2)=NO1)B(O)O |
| InChI | InChI=1S/C26H30BN5O5/c1-17(2)12-23(27(35)36)31-25(34)26(13-18-8-4-3-5-9-18)14-19(32-37-26)15-29-24(33)22-16-28-20-10-6-7-11-21(20)30-22/h3-11,16-17,23,35-36H,12-15H2,1-2H3,(H,29,33)(H,31,34) |
| InChIKey | JCBWRLHUDOYBQX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 146.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|