C27H31BN2O5 — CID 163398113
[(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 163398113) has the molecular formula C27H31BN2O5 and a molecular weight of 474.37 g/mol. Its IUPAC name is [(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 163398113 |
| Molecular Formula | C27H31BN2O5 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)C1(Cc2ccccc2)CC(COc2ccc3ccccc3c2)=NO1)B(O)O |
| InChI | InChI=1S/C27H31BN2O5/c1-19(2)14-25(28(32)33)29-26(31)27(16-20-8-4-3-5-9-20)17-23(30-35-27)18-34-24-13-12-21-10-6-7-11-22(21)15-24/h3-13,15,19,25,32-33H,14,16-18H2,1-2H3,(H,29,31)/t25-,27?/m0/s1 |
| InChIKey | ZFCMTJUVAPBJEG-PVCWFJFTSA-N |
| XLogP | 3.52 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|