C24H30BClN2O5 — CID 174058299
[1-[[5-benzyl-3-[(3-chlorophenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 174058299) has the molecular formula C24H30BClN2O5 and a molecular weight of 472.78 g/mol. Its IUPAC name is [1-[[5-benzyl-3-[(3-chlorophenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [1-[[5-benzyl-3-[(3-chlorophenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 174058299 |
| Molecular Formula | C24H30BClN2O5 |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [1-[[5-benzyl-3-[(3-chlorophenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C1(Cc2ccccc2)CC(COCc2cccc(Cl)c2)=NO1)B(O)O |
| InChI | InChI=1S/C24H30BClN2O5/c1-17(2)11-22(25(30)31)27-23(29)24(13-18-7-4-3-5-8-18)14-21(28-33-24)16-32-15-19-9-6-10-20(26)12-19/h3-10,12,17,22,30-31H,11,13-16H2,1-2H3,(H,27,29) |
| InChIKey | QXTYTDROSVIFRK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|