C25H33BN2O5 — CID 163398061
[(1R)-1-[[5-benzyl-3-[(3-methylphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 163398061) has the molecular formula C25H33BN2O5 and a molecular weight of 452.36 g/mol. Its IUPAC name is [(1R)-1-[[5-benzyl-3-[(3-methylphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[5-benzyl-3-[(3-methylphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 163398061 |
| Molecular Formula | C25H33BN2O5 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | [(1R)-1-[[5-benzyl-3-[(3-methylphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | Cc1cccc(COCC2=NOC(Cc3ccccc3)(C(=O)N[C@@H](CC(C)C)B(O)O)C2)c1 |
| InChI | InChI=1S/C25H33BN2O5/c1-18(2)12-23(26(30)31)27-24(29)25(14-20-9-5-4-6-10-20)15-22(28-33-25)17-32-16-21-11-7-8-19(3)13-21/h4-11,13,18,23,30-31H,12,14-17H2,1-3H3,(H,27,29)/t23-,25?/m0/s1 |
| InChIKey | PUNHGLIHCVTFDC-LFQPHHBNSA-N |
| XLogP | 2.81 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|