C25H33BN2O6 — CID 163398239
[(1R)-1-[[5-benzyl-3-[(4-methoxyphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 163398239) has the molecular formula C25H33BN2O6 and a molecular weight of 468.36 g/mol. Its IUPAC name is [(1R)-1-[[5-benzyl-3-[(4-methoxyphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[5-benzyl-3-[(4-methoxyphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 163398239 |
| Molecular Formula | C25H33BN2O6 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [(1R)-1-[[5-benzyl-3-[(4-methoxyphenyl)methoxymethyl]-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | COc1ccc(COCC2=NOC(Cc3ccccc3)(C(=O)N[C@@H](CC(C)C)B(O)O)C2)cc1 |
| InChI | InChI=1S/C25H33BN2O6/c1-18(2)13-23(26(30)31)27-24(29)25(14-19-7-5-4-6-8-19)15-21(28-34-25)17-33-16-20-9-11-22(32-3)12-10-20/h4-12,18,23,30-31H,13-17H2,1-3H3,(H,27,29)/t23-,25?/m0/s1 |
| InChIKey | IRXVRSGINAAAJE-LFQPHHBNSA-N |
| XLogP | 2.51 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|