C30H29BN2O5 — CID 163398087
[(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-2-phenylethyl]boronic acid (PubChem CID 163398087) has the molecular formula C30H29BN2O5 and a molecular weight of 508.38 g/mol. Its IUPAC name is [(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 163398087 |
| Molecular Formula | C30H29BN2O5 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | [(1R)-1-[[5-benzyl-3-(naphthalen-2-yloxymethyl)-4H-1,2-oxazole-5-carbonyl]amino]-2-phenylethyl]boronic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)B(O)O)C1(Cc2ccccc2)CC(COc2ccc3ccccc3c2)=NO1 |
| InChI | InChI=1S/C30H29BN2O5/c34-29(32-28(31(35)36)17-22-9-3-1-4-10-22)30(19-23-11-5-2-6-12-23)20-26(33-38-30)21-37-27-16-15-24-13-7-8-14-25(24)18-27/h1-16,18,28,35-36H,17,19-21H2,(H,32,34)/t28-,30?/m0/s1 |
| InChIKey | FXIWOGLLXSCYSB-MBCWZBCWSA-N |
| XLogP | 3.72 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|