C40H43BN2O5 — CID 170550324
5-benzyl-3-(naphthalen-2-yloxymethyl)-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 170550324) has the molecular formula C40H43BN2O5 and a molecular weight of 642.61 g/mol. Its IUPAC name is 5-benzyl-3-(naphthalen-2-yloxymethyl)-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 5-benzyl-3-(naphthalen-2-yloxymethyl)-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 170550324 |
| Molecular Formula | C40H43BN2O5 |
| Molecular Weight | 642.61 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | 5-benzyl-3-(naphthalen-2-yloxymethyl)-N-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4ccccc4)NC(=O)C4(Cc5ccccc5)CC(COc5ccc6ccccc6c5)=NO4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C40H43BN2O5/c1-38(2)31-22-34(38)39(3)35(23-31)46-41(47-39)36(20-27-12-6-4-7-13-27)42-37(44)40(24-28-14-8-5-9-15-28)25-32(43-48-40)26-45-33-19-18-29-16-10-11-17-30(29)21-33/h4-19,21,31,34-36H,20,22-26H2,1-3H3,(H,42,44)/t31-,34-,35+,36-,39-,40?/m0/s1 |
| InChIKey | SRHGODSRGMEKIB-YCBHOKIBSA-N |
| XLogP | 6.97 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|