C36H49BN2O4 — CID 163398485
5-benzyl-3-(3-tert-butylphenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 163398485) has the molecular formula C36H49BN2O4 and a molecular weight of 584.61 g/mol. Its IUPAC name is 5-benzyl-3-(3-tert-butylphenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 5-benzyl-3-(3-tert-butylphenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 163398485 |
| Molecular Formula | C36H49BN2O4 |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.38 |
| IUPAC Name | 5-benzyl-3-(3-tert-butylphenyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)C1(Cc2ccccc2)CC(c2cccc(C(C)(C)C)c2)=NO1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C36H49BN2O4/c1-23(2)17-31(37-41-30-20-27-19-29(34(27,6)7)35(30,8)42-37)38-32(40)36(21-24-13-10-9-11-14-24)22-28(39-43-36)25-15-12-16-26(18-25)33(3,4)5/h9-16,18,23,27,29-31H,17,19-22H2,1-8H3,(H,38,40)/t27-,29-,30+,31-,35-,36?/m0/s1 |
| InChIKey | ZKWAVGKZIRHJLK-VROHFOJSSA-N |
| XLogP | 6.89 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|