5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid

C18H17NO4 — CID 163398280

IUPAC5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1(Cc2ccccc2)CC(COc2ccccc2)=NO1
InChIInChI=1S/C18H17NO4/c20-17(21)18(11-14-7-3-1-4-8-14)12-15(19-23-18)13-22-16-9-5-2-6-10-16/h1-10H,11-13H2,(H,20,21)
InChIKeyVLMSEVDHCRHFDT-UHFFFAOYSA-N
MW311.34 g/mol
LogP2.91
Rot. Bonds6

About 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid

5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 163398280) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid
PubChem CID163398280
Molecular FormulaC18H17NO4
Molecular Weight311.34 g/mol
Exact Mass311.12
IUPAC Name5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1(Cc2ccccc2)CC(COc2ccccc2)=NO1
InChIInChI=1S/C18H17NO4/c20-17(21)18(11-14-7-3-1-4-8-14)12-15(19-23-18)13-22-16-9-5-2-6-10-16/h1-10H,11-13H2,(H,20,21)
InChIKeyVLMSEVDHCRHFDT-UHFFFAOYSA-N
XLogP2.91
TPSA68.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.34
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid (CID 163398280) is 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid is O=C(O)C1(Cc2ccccc2)CC(COc2ccccc2)=NO1.
What is the InChIKey of 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is VLMSEVDHCRHFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO4/c20-17(21)18(11-14-7-3-1-4-8-14)12-15(19-23-18)13-22-16-9-5-2-6-10-16/h1-10H,11-13H2,(H,20,21).
What are the key properties of 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid?
5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 311.34 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3-(phenoxymethyl)-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 163398280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).