C23H26BClN2O3 — CID 172783264
CID 172783264 (PubChem CID 172783264) has the molecular formula C23H26BClN2O3 and a molecular weight of 424.74 g/mol.
| Compound Name | CID 172783264 |
|---|---|
| PubChem CID | 172783264 |
| Molecular Formula | C23H26BClN2O3 |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | — |
| SMILES | [B][C@H](CC(C)C)NC(=O)C1(Cc2ccccc2)CC(COc2cccc(Cl)c2)=NO1 |
| InChI | InChI=1S/C23H26BClN2O3/c1-16(2)11-21(24)26-22(28)23(13-17-7-4-3-5-8-17)14-19(27-30-23)15-29-20-10-6-9-18(25)12-20/h3-10,12,16,21H,11,13-15H2,1-2H3,(H,26,28)/t21-,23?/m0/s1 |
| InChIKey | ONVIQDSVDDPBBS-BBQAJUCSSA-N |
| XLogP | 4.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|