C22H27BN2O4 — CID 163398497
[(1R)-1-[[(5S)-5-benzyl-3-phenyl-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 163398497) has the molecular formula C22H27BN2O4 and a molecular weight of 394.28 g/mol. Its IUPAC name is [(1R)-1-[[(5S)-5-benzyl-3-phenyl-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(5S)-5-benzyl-3-phenyl-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 163398497 |
| Molecular Formula | C22H27BN2O4 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(1R)-1-[[(5S)-5-benzyl-3-phenyl-4H-1,2-oxazole-5-carbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@]1(Cc2ccccc2)CC(c2ccccc2)=NO1)B(O)O |
| InChI | InChI=1S/C22H27BN2O4/c1-16(2)13-20(23(27)28)24-21(26)22(14-17-9-5-3-6-10-17)15-19(25-29-22)18-11-7-4-8-12-18/h3-12,16,20,27-28H,13-15H2,1-2H3,(H,24,26)/t20-,22-/m0/s1 |
| InChIKey | SCAPLGMQESODDP-UNMCSNQZSA-N |
| XLogP | 2.34 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|