C16H15NO2 — CID 14688929
(3,5-diphenyl-4H-1,2-oxazol-5-yl)methanol (PubChem CID 14688929) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (3,5-diphenyl-4H-1,2-oxazol-5-yl)methanol.
| Compound Name | (3,5-diphenyl-4H-1,2-oxazol-5-yl)methanol |
|---|---|
| PubChem CID | 14688929 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3,5-diphenyl-4H-1,2-oxazol-5-yl)methanol |
| SMILES | OCC1(c2ccccc2)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C16H15NO2/c18-12-16(14-9-5-2-6-10-14)11-15(17-19-16)13-7-3-1-4-8-13/h1-10,18H,11-12H2 |
| InChIKey | FNZKEPGVQMASLF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |