C11H12ClNO — CID 12533400
5-(chloromethyl)-5-methyl-3-phenyl-4H-1,2-oxazole (PubChem CID 12533400) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 5-(chloromethyl)-5-methyl-3-phenyl-4H-1,2-oxazole.
| Compound Name | 5-(chloromethyl)-5-methyl-3-phenyl-4H-1,2-oxazole |
|---|---|
| PubChem CID | 12533400 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 5-(chloromethyl)-5-methyl-3-phenyl-4H-1,2-oxazole |
| SMILES | CC1(CCl)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C11H12ClNO/c1-11(8-12)7-10(13-14-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | AKUKOFKLSGIVPX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|