C23H18N2O — CID 71554495
4-(5-benzyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile (PubChem CID 71554495) has the molecular formula C23H18N2O and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-(5-benzyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile.
| Compound Name | 4-(5-benzyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile |
|---|---|
| PubChem CID | 71554495 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-(5-benzyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2=NOC(Cc3ccccc3)(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H18N2O/c24-17-19-11-13-20(14-12-19)22-16-23(26-25-22,21-9-5-2-6-10-21)15-18-7-3-1-4-8-18/h1-14H,15-16H2 |
| InChIKey | AERRDTTYQBQETE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |