C17H14N2O — CID 71562092
4-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile (PubChem CID 71562092) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile.
| Compound Name | 4-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 71562092 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2=NO[C@H](Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C17H14N2O/c18-12-14-6-8-15(9-7-14)17-11-16(20-19-17)10-13-4-2-1-3-5-13/h1-9,16H,10-11H2/t16-/m1/s1 |
| InChIKey | PXLRIDIOCCNJAD-MRXNPFEDSA-N |
| XLogP | 3.29 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |