C16H14FNO — CID 71561970
(5R)-5-benzyl-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 71561970) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is (5R)-5-benzyl-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | (5R)-5-benzyl-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 71561970 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (5R)-5-benzyl-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | Fc1cccc(C2=NO[C@H](Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C16H14FNO/c17-14-8-4-7-13(10-14)16-11-15(19-18-16)9-12-5-2-1-3-6-12/h1-8,10,15H,9,11H2/t15-/m1/s1 |
| InChIKey | BIJSWCRELIGYBA-OAHLLOKOSA-N |
| XLogP | 3.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |