C10H10INO — CID 72741218
5-(iodomethyl)-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 72741218) has the molecular formula C10H10INO and a molecular weight of 287.10 g/mol. Its IUPAC name is 5-(iodomethyl)-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(iodomethyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 72741218 |
| Molecular Formula | C10H10INO |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 5-(iodomethyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | ICC1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C10H10INO/c11-7-9-6-10(12-13-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | FDUWJYHUOWQFIU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|