C16H22N2O — CID 143117343
N-[3-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)prop-1-en-2-yl]butan-1-amine (PubChem CID 143117343) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-[3-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)prop-1-en-2-yl]butan-1-amine.
| Compound Name | N-[3-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)prop-1-en-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 143117343 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[3-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)prop-1-en-2-yl]butan-1-amine |
| SMILES | C=C(CC1CC(c2ccccc2)=NO1)NCCCC |
| InChI | InChI=1S/C16H22N2O/c1-3-4-10-17-13(2)11-15-12-16(18-19-15)14-8-6-5-7-9-14/h5-9,15,17H,2-4,10-12H2,1H3 |
| InChIKey | BUXTTXFVMRERFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|