C12H15NO2 — CID 15668474
(1R)-1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propan-1-ol (PubChem CID 15668474) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (1R)-1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propan-1-ol.
| Compound Name | (1R)-1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 15668474 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (1R)-1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]propan-1-ol |
| SMILES | CC[C@@H](O)[C@@H]1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C12H15NO2/c1-2-11(14)12-8-10(13-15-12)9-6-4-3-5-7-9/h3-7,11-12,14H,2,8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | BFFRMKGDXONMOO-NEPJUHHUSA-N |
| XLogP | 1.95 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |