C17H17NO2 — CID 11471142
(1S)-1-phenyl-2-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol (PubChem CID 11471142) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (1S)-1-phenyl-2-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol.
| Compound Name | (1S)-1-phenyl-2-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 11471142 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (1S)-1-phenyl-2-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
| SMILES | O[C@@H](C[C@@H]1CC(c2ccccc2)=NO1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c19-17(14-9-5-2-6-10-14)12-15-11-16(18-20-15)13-7-3-1-4-8-13/h1-10,15,17,19H,11-12H2/t15-,17-/m0/s1 |
| InChIKey | DFTHUEJCPNSYAP-RDJZCZTQSA-N |
| XLogP | 3.30 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |