C16H16N2O2 — CID 14899368
2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-1-pyridin-3-ylethanol (PubChem CID 14899368) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-1-pyridin-3-ylethanol.
| Compound Name | 2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 14899368 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)-1-pyridin-3-ylethanol |
| SMILES | OC(CC1CC(c2ccccc2)=NO1)c1cccnc1 |
| InChI | InChI=1S/C16H16N2O2/c19-16(13-7-4-8-17-11-13)10-14-9-15(18-20-14)12-5-2-1-3-6-12/h1-8,11,14,16,19H,9-10H2 |
| InChIKey | JGLWBVZNYNQTDU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |