C11H11NO2 — CID 822979
1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone (PubChem CID 822979) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone.
| Compound Name | 1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 822979 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C11H11NO2/c1-8(13)11-7-10(12-14-11)9-5-3-2-4-6-9/h2-6,11H,7H2,1H3/t11-/m0/s1 |
| InChIKey | PVMHBTFGOMDWET-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |