C17H15NO3 — CID 14998593
benzyl 3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 14998593) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is benzyl 3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | benzyl 3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 14998593 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | benzyl 3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C17H15NO3/c19-17(20-12-13-7-3-1-4-8-13)16-11-15(18-21-16)14-9-5-2-6-10-14/h1-10,16H,11-12H2 |
| InChIKey | XRVGKGGISAXAAZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |