C14H18N2O3 — CID 115410297
N-(2-methylpropoxy)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 115410297) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(2-methylpropoxy)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-methylpropoxy)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 115410297 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(2-methylpropoxy)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CC(C)CONC(=O)C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C14H18N2O3/c1-10(2)9-18-16-14(17)13-8-12(15-19-13)11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | WBTIVQWEJUYRAX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|