C37H34N4O4 — CID 99727422
[(4R,5R)-2,2-dimethyl-4,5-diphenyl-3-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl]imidazolidin-1-yl]-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanone (PubChem CID 99727422) has the molecular formula C37H34N4O4 and a molecular weight of 598.70 g/mol. Its IUPAC name is [(4R,5R)-2,2-dimethyl-4,5-diphenyl-3-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl]imidazolidin-1-yl]-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanone.
| Compound Name | [(4R,5R)-2,2-dimethyl-4,5-diphenyl-3-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl]imidazolidin-1-yl]-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 99727422 |
| Molecular Formula | C37H34N4O4 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | [(4R,5R)-2,2-dimethyl-4,5-diphenyl-3-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl]imidazolidin-1-yl]-[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanone |
| SMILES | CC1(C)N(C(=O)[C@@H]2CC(c3ccccc3)=NO2)[C@H](c2ccccc2)[C@@H](c2ccccc2)N1C(=O)[C@H]1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C37H34N4O4/c1-37(2)40(35(42)31-23-29(38-44-31)25-15-7-3-8-16-25)33(27-19-11-5-12-20-27)34(28-21-13-6-14-22-28)41(37)36(43)32-24-30(39-45-32)26-17-9-4-10-18-26/h3-22,31-34H,23-24H2,1-2H3/t31-,32+,33-,34-/m1/s1 |
| InChIKey | XPWWDQPZXOGSGQ-KMKAFXEASA-N |
| XLogP | 6.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |