C14H13N3O4 — CID 66085871
4-(3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl)piperazine-2,6-dione (PubChem CID 66085871) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-(3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66085871 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-(3-phenyl-4,5-dihydro-1,2-oxazole-5-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)C2CC(c3ccccc3)=NO2)CC(=O)N1 |
| InChI | InChI=1S/C14H13N3O4/c18-12-7-17(8-13(19)15-12)14(20)11-6-10(16-21-11)9-4-2-1-3-5-9/h1-5,11H,6-8H2,(H,15,18,19) |
| InChIKey | BSNRKTCZOWIAQJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|