C27H23N3O6 — CID 2815796
bis[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl] pyridine-2,6-dicarboxylate (PubChem CID 2815796) has the molecular formula C27H23N3O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is bis[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 2815796 |
| Molecular Formula | C27H23N3O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | bis[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl] pyridine-2,6-dicarboxylate |
| SMILES | O=C(OCC1CC(c2ccccc2)=NO1)c1cccc(C(=O)OCC2CC(c3ccccc3)=NO2)n1 |
| InChI | InChI=1S/C27H23N3O6/c31-26(33-16-20-14-24(29-35-20)18-8-3-1-4-9-18)22-12-7-13-23(28-22)27(32)34-17-21-15-25(30-36-21)19-10-5-2-6-11-19/h1-13,20-21H,14-17H2 |
| InChIKey | BHUQMOMTBYDIEF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 108.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |