C16H15NO2 — CID 71561964
3-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]phenol (PubChem CID 71561964) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]phenol.
| Compound Name | 3-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]phenol |
|---|---|
| PubChem CID | 71561964 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[(5R)-5-benzyl-4,5-dihydro-1,2-oxazol-3-yl]phenol |
| SMILES | Oc1cccc(C2=NO[C@H](Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C16H15NO2/c18-14-8-4-7-13(10-14)16-11-15(19-17-16)9-12-5-2-1-3-6-12/h1-8,10,15,18H,9,11H2/t15-/m1/s1 |
| InChIKey | CMZNXRVWBPGLJF-OAHLLOKOSA-N |
| XLogP | 3.13 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |