C15H16N2O2S — CID 100949116
S-propyl 2-[(5R)-3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethanethioate (PubChem CID 100949116) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is S-propyl 2-[(5R)-3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethanethioate.
| Compound Name | S-propyl 2-[(5R)-3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethanethioate |
|---|---|
| PubChem CID | 100949116 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | S-propyl 2-[(5R)-3-(4-cyanophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethanethioate |
| SMILES | CCCSC(=O)C[C@H]1CC(c2ccc(C#N)cc2)=NO1 |
| InChI | InChI=1S/C15H16N2O2S/c1-2-7-20-15(18)9-13-8-14(17-19-13)12-5-3-11(10-16)4-6-12/h3-6,13H,2,7-9H2,1H3/t13-/m1/s1 |
| InChIKey | QNMWATYRPLRXKV-CYBMUJFWSA-N |
| XLogP | 3.11 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|