C14H16N2O — CID 25136573
3-(5-butyl-4,5-dihydro-1,2-oxazol-3-yl)benzonitrile (PubChem CID 25136573) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-(5-butyl-4,5-dihydro-1,2-oxazol-3-yl)benzonitrile.
| Compound Name | 3-(5-butyl-4,5-dihydro-1,2-oxazol-3-yl)benzonitrile |
|---|---|
| PubChem CID | 25136573 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-(5-butyl-4,5-dihydro-1,2-oxazol-3-yl)benzonitrile |
| SMILES | CCCCC1CC(c2cccc(C#N)c2)=NO1 |
| InChI | InChI=1S/C14H16N2O/c1-2-3-7-13-9-14(16-17-13)12-6-4-5-11(8-12)10-15/h4-6,8,13H,2-3,7,9H2,1H3 |
| InChIKey | UNGFKNNBLXQMAF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |