C13H14N2O4 — CID 18753375
4-[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal (PubChem CID 18753375) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal.
| Compound Name | 4-[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal |
|---|---|
| PubChem CID | 18753375 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal |
| SMILES | O=CCCCC1CC(c2cccc([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C13H14N2O4/c16-7-2-1-6-12-9-13(14-19-12)10-4-3-5-11(8-10)15(17)18/h3-5,7-8,12H,1-2,6,9H2 |
| InChIKey | OOBHRHRZWWGKHH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|