C28H25N5O5 — CID 24747815
N-[(2-methoxyphenyl)methyl]-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylpyrazole-5-carboxamide (PubChem CID 24747815) has the molecular formula C28H25N5O5 and a molecular weight of 511.54 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylpyrazole-5-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 24747815 |
| Molecular Formula | C28H25N5O5 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-3-phenylpyrazole-5-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cc(-c2ccccc2)nn1CC1CC(c2cccc([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C28H25N5O5/c1-37-27-13-6-5-10-21(27)17-29-28(34)26-16-24(19-8-3-2-4-9-19)30-32(26)18-23-15-25(31-38-23)20-11-7-12-22(14-20)33(35)36/h2-14,16,23H,15,17-18H2,1H3,(H,29,34) |
| InChIKey | FTNQZBXWJPZULV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|