C10H10N2O4 — CID 11390420
[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 11390420) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is [3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 11390420 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | O=[N+]([O-])c1cccc(C2=NOC(CO)C2)c1 |
| InChI | InChI=1S/C10H10N2O4/c13-6-9-5-10(11-16-9)7-2-1-3-8(4-7)12(14)15/h1-4,9,13H,5-6H2 |
| InChIKey | FCGYKBUGFSTOIO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|