C20H19FN4O4 — CID 55780882
[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 55780882) has the molecular formula C20H19FN4O4 and a molecular weight of 398.39 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55780882 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CC(c2cccc(F)c2)=NO1)N1CCN(c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H19FN4O4/c21-15-4-1-3-14(11-15)18-13-19(29-22-18)20(26)24-9-7-23(8-10-24)16-5-2-6-17(12-16)25(27)28/h1-6,11-12,19H,7-10,13H2 |
| InChIKey | YVULCFGJVAKRAK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|