C20H20FN3O3 — CID 43071663
3-(3-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 43071663) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 43071663 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)C1CC(c2cccc(F)c2)=NO1 |
| InChI | InChI=1S/C20H20FN3O3/c21-15-3-1-2-14(12-15)18-13-19(27-23-18)20(25)22-16-4-6-17(7-5-16)24-8-10-26-11-9-24/h1-7,12,19H,8-11,13H2,(H,22,25) |
| InChIKey | UGDBPUBLYHMZAC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|