C22H23F2N3O3 — CID 55799770
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 55799770) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 55799770 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CC1CN(c2ccc(NC(=O)C3CC(c4cccc(F)c4)=NO3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C22H23F2N3O3/c1-13-11-27(12-14(2)29-13)20-7-6-17(9-18(20)24)25-22(28)21-10-19(26-30-21)15-4-3-5-16(23)8-15/h3-9,13-14,21H,10-12H2,1-2H3,(H,25,28) |
| InChIKey | WQWCOHSYFYBGOP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|