C29H27N5O5 — CID 25102737
N-[(2-methoxyphenyl)methyl]-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide (PubChem CID 25102737) has the molecular formula C29H27N5O5 and a molecular weight of 525.57 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25102737 |
| Molecular Formula | C29H27N5O5 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-5-(2-methylphenyl)-1-[[3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrazole-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1cc(-c2ccccc2C)n(CC2CC(c3cccc([N+](=O)[O-])c3)=NO2)n1 |
| InChI | InChI=1S/C29H27N5O5/c1-19-8-3-5-12-24(19)27-16-26(29(35)30-17-21-9-4-6-13-28(21)38-2)31-33(27)18-23-15-25(32-39-23)20-10-7-11-22(14-20)34(36)37/h3-14,16,23H,15,17-18H2,1-2H3,(H,30,35) |
| InChIKey | COFMXHXIUKNMPD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|