C11H10N2O4 — CID 122208756
(5R)-5-ethenyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-ol (PubChem CID 122208756) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is (5R)-5-ethenyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-ol.
| Compound Name | (5R)-5-ethenyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 122208756 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (5R)-5-ethenyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-ol |
| SMILES | C=C[C@@]1(O)CC(c2cccc([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C11H10N2O4/c1-2-11(14)7-10(12-17-11)8-4-3-5-9(6-8)13(15)16/h2-6,14H,1,7H2/t11-/m0/s1 |
| InChIKey | GXQXMMPFYVAOEX-NSHDSACASA-N |
| XLogP | 1.59 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|