C18H13ClN4O4 — CID 24789316
2-(3-chlorophenyl)-5-[5-methyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-yl]-1,3,4-oxadiazole (PubChem CID 24789316) has the molecular formula C18H13ClN4O4 and a molecular weight of 384.78 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[5-methyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-chlorophenyl)-5-[5-methyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 24789316 |
| Molecular Formula | C18H13ClN4O4 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[5-methyl-3-(3-nitrophenyl)-4H-1,2-oxazol-5-yl]-1,3,4-oxadiazole |
| SMILES | CC1(c2nnc(-c3cccc(Cl)c3)o2)CC(c2cccc([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C18H13ClN4O4/c1-18(17-21-20-16(26-17)12-5-2-6-13(19)8-12)10-15(22-27-18)11-4-3-7-14(9-11)23(24)25/h2-9H,10H2,1H3 |
| InChIKey | PTHPXKRBFVZEEA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 103.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|