C17H13BrCl2N2O3 — CID 59407447
3-[4-(bromomethyl)-3-nitrophenyl]-5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazole (PubChem CID 59407447) has the molecular formula C17H13BrCl2N2O3 and a molecular weight of 444.11 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-3-nitrophenyl]-5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazole.
| Compound Name | 3-[4-(bromomethyl)-3-nitrophenyl]-5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazole |
|---|---|
| PubChem CID | 59407447 |
| Molecular Formula | C17H13BrCl2N2O3 |
| Molecular Weight | 444.11 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | 3-[4-(bromomethyl)-3-nitrophenyl]-5-(3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazole |
| SMILES | CC1(c2cc(Cl)cc(Cl)c2)CC(c2ccc(CBr)c([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C17H13BrCl2N2O3/c1-17(12-5-13(19)7-14(20)6-12)8-15(21-25-17)10-2-3-11(9-18)16(4-10)22(23)24/h2-7H,8-9H2,1H3 |
| InChIKey | LEBPJTOVDFJMJT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.11 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|