C18H12Br2Cl2F3NO — CID 58200076
3-[3,4-bis(bromomethyl)phenyl]-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 58200076) has the molecular formula C18H12Br2Cl2F3NO and a molecular weight of 546.01 g/mol. Its IUPAC name is 3-[3,4-bis(bromomethyl)phenyl]-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
| Compound Name | 3-[3,4-bis(bromomethyl)phenyl]-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 58200076 |
| Molecular Formula | C18H12Br2Cl2F3NO |
| Molecular Weight | 546.01 g/mol |
| Exact Mass | 542.86 |
| IUPAC Name | 3-[3,4-bis(bromomethyl)phenyl]-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | FC(F)(F)C1(c2cc(Cl)cc(Cl)c2)CC(c2ccc(CBr)c(CBr)c2)=NO1 |
| InChI | InChI=1S/C18H12Br2Cl2F3NO/c19-8-11-2-1-10(3-12(11)9-20)16-7-17(27-26-16,18(23,24)25)13-4-14(21)6-15(22)5-13/h1-6H,7-9H2 |
| InChIKey | NHYVAVPSQUHWOO-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.01 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|