C17H12Cl3F4N2O+ — CID 58468230
[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylazanium (PubChem CID 58468230) has the molecular formula C17H12Cl3F4N2O+ and a molecular weight of 442.65 g/mol. Its IUPAC name is [2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylazanium.
| Compound Name | [2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylazanium |
|---|---|
| PubChem CID | 58468230 |
| Molecular Formula | C17H12Cl3F4N2O+ |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | [2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylazanium |
| SMILES | [NH3+]Cc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1F |
| InChI | InChI=1S/C17H11Cl3F4N2O/c18-11-4-10(5-12(19)15(11)20)16(17(22,23)24)6-14(26-27-16)8-1-2-13(21)9(3-8)7-25/h1-5H,6-7,25H2/p+1 |
| InChIKey | ZHFLTBDUHJOBDQ-UHFFFAOYSA-O |
| XLogP | 5.11 |
| TPSA | 49.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|