C17H11Cl3F3NO — CID 141356805
(5S)-3-(3-methylphenyl)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 141356805) has the molecular formula C17H11Cl3F3NO and a molecular weight of 408.63 g/mol. Its IUPAC name is (5S)-3-(3-methylphenyl)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
| Compound Name | (5S)-3-(3-methylphenyl)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 141356805 |
| Molecular Formula | C17H11Cl3F3NO |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | (5S)-3-(3-methylphenyl)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | Cc1cccc(C2=NO[C@@](c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C17H11Cl3F3NO/c1-9-3-2-4-10(5-9)14-8-16(25-24-14,17(21,22)23)11-6-12(18)15(20)13(19)7-11/h2-7H,8H2,1H3/t16-/m0/s1 |
| InChIKey | APKKYNLZSHWFKB-INIZCTEOSA-N |
| XLogP | 6.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|