C21H18Cl3F4N3O — CID 163743066
1-[3-fluoro-3-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclobutyl]-2-methylhydrazine (PubChem CID 163743066) has the molecular formula C21H18Cl3F4N3O and a molecular weight of 510.75 g/mol. Its IUPAC name is 1-[3-fluoro-3-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclobutyl]-2-methylhydrazine.
| Compound Name | 1-[3-fluoro-3-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclobutyl]-2-methylhydrazine |
|---|---|
| PubChem CID | 163743066 |
| Molecular Formula | C21H18Cl3F4N3O |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | 1-[3-fluoro-3-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclobutyl]-2-methylhydrazine |
| SMILES | CNNC1CC(F)(c2ccc(C3=NOC(c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)cc2)C1 |
| InChI | InChI=1S/C21H18Cl3F4N3O/c1-29-30-14-8-19(25,9-14)12-4-2-11(3-5-12)17-10-20(32-31-17,21(26,27)28)13-6-15(22)18(24)16(23)7-13/h2-7,14,29-30H,8-10H2,1H3 |
| InChIKey | LJLINIKDTNWPBK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|