C21H16Cl3F3N2O3 — CID 86707795
methyl 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylate (PubChem CID 86707795) has the molecular formula C21H16Cl3F3N2O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is methyl 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 86707795 |
| Molecular Formula | C21H16Cl3F3N2O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | methyl 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(c2ccc(C3=NOC(c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)cc2)C1 |
| InChI | InChI=1S/C21H16Cl3F3N2O3/c1-31-19(30)12-9-29(10-12)14-4-2-11(3-5-14)17-8-20(32-28-17,21(25,26)27)13-6-15(22)18(24)16(23)7-13/h2-7,12H,8-10H2,1H3 |
| InChIKey | CIFPOAPPUVDNRD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|