C19H13Cl2F5N2O — CID 71679810
(5S)-5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 71679810) has the molecular formula C19H13Cl2F5N2O and a molecular weight of 451.22 g/mol. Its IUPAC name is (5S)-5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazole.
| Compound Name | (5S)-5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 71679810 |
| Molecular Formula | C19H13Cl2F5N2O |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | (5S)-5-(3,5-dichloro-4-fluorophenyl)-3-[4-(3-fluoroazetidin-3-yl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | Fc1c(Cl)cc([C@]2(C(F)(F)F)CC(c3ccc(C4(F)CNC4)cc3)=NO2)cc1Cl |
| InChI | InChI=1S/C19H13Cl2F5N2O/c20-13-5-12(6-14(21)16(13)22)18(19(24,25)26)7-15(28-29-18)10-1-3-11(4-2-10)17(23)8-27-9-17/h1-6,27H,7-9H2/t18-/m0/s1 |
| InChIKey | KGWBVTDKNZMVSD-SFHVURJKSA-N |
| XLogP | 5.48 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|