C10H6Cl2F4N2O — CID 164873478
5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine (PubChem CID 164873478) has the molecular formula C10H6Cl2F4N2O and a molecular weight of 317.07 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine.
| Compound Name | 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 164873478 |
| Molecular Formula | C10H6Cl2F4N2O |
| Molecular Weight | 317.07 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine |
| SMILES | NC1=NOC(c2cc(Cl)c(F)c(Cl)c2)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H6Cl2F4N2O/c11-5-1-4(2-6(12)8(5)13)9(10(14,15)16)3-7(17)18-19-9/h1-2H,3H2,(H2,17,18) |
| InChIKey | PLURXXZGFRGACW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.07 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|