C10H7Cl2F4NO — CID 123673594
5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazolidine (PubChem CID 123673594) has the molecular formula C10H7Cl2F4NO and a molecular weight of 304.07 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazolidine.
| Compound Name | 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 123673594 |
| Molecular Formula | C10H7Cl2F4NO |
| Molecular Weight | 304.07 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazolidine |
| SMILES | Fc1c(Cl)cc(C2(C(F)(F)F)CCNO2)cc1Cl |
| InChI | InChI=1S/C10H7Cl2F4NO/c11-6-3-5(4-7(12)8(6)13)9(10(14,15)16)1-2-17-18-9/h3-4,17H,1-2H2 |
| InChIKey | PUDOCIWVRVBFJY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.07 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|