C18H12Cl2F4N2O2 — CID 154015198
3-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide (PubChem CID 154015198) has the molecular formula C18H12Cl2F4N2O2 and a molecular weight of 435.20 g/mol. Its IUPAC name is 3-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide.
| Compound Name | 3-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 154015198 |
| Molecular Formula | C18H12Cl2F4N2O2 |
| Molecular Weight | 435.20 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 3-[(5S)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide |
| SMILES | Cc1c(C(N)=O)cccc1C1=NO[C@@](c2cc(Cl)c(F)c(Cl)c2)(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H12Cl2F4N2O2/c1-8-10(3-2-4-11(8)16(25)27)14-7-17(28-26-14,18(22,23)24)9-5-12(19)15(21)13(20)6-9/h2-6H,7H2,1H3,(H2,25,27)/t17-/m0/s1 |
| InChIKey | XFZOMWLBJHHHPH-KRWDZBQOSA-N |
| XLogP | 5.12 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.20 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|